C32H32F3N3O2 — CID 177017050
3-[6-[2-[[4-(trifluoromethyl)phenyl]methyl]-2-azaspiro[5.5]undec-4-en-5-yl]quinolin-3-yl]piperidine-2,6-dione (PubChem CID 177017050) has the molecular formula C32H32F3N3O2 and a molecular weight of 547.62 g/mol. Its IUPAC name is 3-[6-[2-[[4-(trifluoromethyl)phenyl]methyl]-2-azaspiro[5.5]undec-4-en-5-yl]quinolin-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[2-[[4-(trifluoromethyl)phenyl]methyl]-2-azaspiro[5.5]undec-4-en-5-yl]quinolin-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177017050 |
| Molecular Formula | C32H32F3N3O2 |
| Molecular Weight | 547.62 g/mol |
| Exact Mass | 547.24 |
| IUPAC Name | 3-[6-[2-[[4-(trifluoromethyl)phenyl]methyl]-2-azaspiro[5.5]undec-4-en-5-yl]quinolin-3-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(c2cnc3ccc(C4=CCN(Cc5ccc(C(F)(F)F)cc5)CC45CCCCC5)cc3c2)C(=O)N1 |
| InChI | InChI=1S/C32H32F3N3O2/c33-32(34,35)25-7-4-21(5-8-25)19-38-15-12-27(31(20-38)13-2-1-3-14-31)22-6-10-28-23(16-22)17-24(18-36-28)26-9-11-29(39)37-30(26)40/h4-8,10,12,16-18,26H,1-3,9,11,13-15,19-20H2,(H,37,39,40) |
| InChIKey | VYBOCPOCWCIXCQ-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.62 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|