C27H27F3N4O3 — CID 177015909
3-[2-amino-6-[4-hydroxy-1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]quinolin-3-yl]piperidine-2,6-dione (PubChem CID 177015909) has the molecular formula C27H27F3N4O3 and a molecular weight of 512.53 g/mol. Its IUPAC name is 3-[2-amino-6-[4-hydroxy-1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]quinolin-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[2-amino-6-[4-hydroxy-1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]quinolin-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177015909 |
| Molecular Formula | C27H27F3N4O3 |
| Molecular Weight | 512.53 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | 3-[2-amino-6-[4-hydroxy-1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]quinolin-3-yl]piperidine-2,6-dione |
| SMILES | Nc1nc2ccc(C3(O)CCN(Cc4ccc(C(F)(F)F)cc4)CC3)cc2cc1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C27H27F3N4O3/c28-27(29,30)18-3-1-16(2-4-18)15-34-11-9-26(37,10-12-34)19-5-7-22-17(13-19)14-21(24(31)32-22)20-6-8-23(35)33-25(20)36/h1-5,7,13-14,20,37H,6,8-12,15H2,(H2,31,32)(H,33,35,36) |
| InChIKey | IJBAZYCSYCDBLD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.53 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|