C25H35N3O3 — CID 177016168
3-[6-(1-ethyl-4-hydroxypiperidin-4-yl)quinolin-3-yl]piperidine-2,6-dione;2-methylpropane (PubChem CID 177016168) has the molecular formula C25H35N3O3 and a molecular weight of 425.57 g/mol. Its IUPAC name is 3-[6-(1-ethyl-4-hydroxypiperidin-4-yl)quinolin-3-yl]piperidine-2,6-dione;2-methylpropane.
| Compound Name | 3-[6-(1-ethyl-4-hydroxypiperidin-4-yl)quinolin-3-yl]piperidine-2,6-dione;2-methylpropane |
|---|---|
| PubChem CID | 177016168 |
| Molecular Formula | C25H35N3O3 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | 3-[6-(1-ethyl-4-hydroxypiperidin-4-yl)quinolin-3-yl]piperidine-2,6-dione;2-methylpropane |
| SMILES | CC(C)C.CCN1CCC(O)(c2ccc3ncc(C4CCC(=O)NC4=O)cc3c2)CC1 |
| InChI | InChI=1S/C21H25N3O3.C4H10/c1-2-24-9-7-21(27,8-10-24)16-3-5-18-14(12-16)11-15(13-22-18)17-4-6-19(25)23-20(17)26;1-4(2)3/h3,5,11-13,17,27H,2,4,6-10H2,1H3,(H,23,25,26);4H,1-3H3 |
| InChIKey | YGRHAISUEGRNFT-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|