C25H32FN3O3 — CID 177016984
3-[5-fluoro-6-[(4R)-4-hydroxy-3,3-dimethyl-1-(2-methylpropyl)piperidin-4-yl]quinolin-3-yl]piperidine-2,6-dione (PubChem CID 177016984) has the molecular formula C25H32FN3O3 and a molecular weight of 441.55 g/mol. Its IUPAC name is 3-[5-fluoro-6-[(4R)-4-hydroxy-3,3-dimethyl-1-(2-methylpropyl)piperidin-4-yl]quinolin-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-fluoro-6-[(4R)-4-hydroxy-3,3-dimethyl-1-(2-methylpropyl)piperidin-4-yl]quinolin-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177016984 |
| Molecular Formula | C25H32FN3O3 |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | 3-[5-fluoro-6-[(4R)-4-hydroxy-3,3-dimethyl-1-(2-methylpropyl)piperidin-4-yl]quinolin-3-yl]piperidine-2,6-dione |
| SMILES | CC(C)CN1CC[C@](O)(c2ccc3ncc(C4CCC(=O)NC4=O)cc3c2F)C(C)(C)C1 |
| InChI | InChI=1S/C25H32FN3O3/c1-15(2)13-29-10-9-25(32,24(3,4)14-29)19-6-7-20-18(22(19)26)11-16(12-27-20)17-5-8-21(30)28-23(17)31/h6-7,11-12,15,17,32H,5,8-10,13-14H2,1-4H3,(H,28,30,31)/t17?,25-/m0/s1 |
| InChIKey | KBISRWGNOAYKTH-HHPDBAQJSA-N |
| XLogP | 3.47 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|