C31H30F3N5O4 — CID 177015939
3-[6-[(4R)-1-[[3-(difluoromethyl)-4-(1,2,4-oxadiazol-3-yl)phenyl]methyl]-4-hydroxy-3,3-dimethylpiperidin-4-yl]-5-fluoroquinolin-3-yl]piperidine-2,6-dione (PubChem CID 177015939) has the molecular formula C31H30F3N5O4 and a molecular weight of 593.61 g/mol. Its IUPAC name is 3-[6-[(4R)-1-[[3-(difluoromethyl)-4-(1,2,4-oxadiazol-3-yl)phenyl]methyl]-4-hydroxy-3,3-dimethylpiperidin-4-yl]-5-fluoroquinolin-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[(4R)-1-[[3-(difluoromethyl)-4-(1,2,4-oxadiazol-3-yl)phenyl]methyl]-4-hydroxy-3,3-dimethylpiperidin-4-yl]-5-fluoroquinolin-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177015939 |
| Molecular Formula | C31H30F3N5O4 |
| Molecular Weight | 593.61 g/mol |
| Exact Mass | 593.22 |
| IUPAC Name | 3-[6-[(4R)-1-[[3-(difluoromethyl)-4-(1,2,4-oxadiazol-3-yl)phenyl]methyl]-4-hydroxy-3,3-dimethylpiperidin-4-yl]-5-fluoroquinolin-3-yl]piperidine-2,6-dione |
| SMILES | CC1(C)CN(Cc2ccc(-c3ncon3)c(C(F)F)c2)CC[C@]1(O)c1ccc2ncc(C3CCC(=O)NC3=O)cc2c1F |
| InChI | InChI=1S/C31H30F3N5O4/c1-30(2)15-39(14-17-3-4-20(21(11-17)27(33)34)28-36-16-43-38-28)10-9-31(30,42)23-6-7-24-22(26(23)32)12-18(13-35-24)19-5-8-25(40)37-29(19)41/h3-4,6-7,11-13,16,19,27,42H,5,8-10,14-15H2,1-2H3,(H,37,40,41)/t19?,31-/m0/s1 |
| InChIKey | PTEAZJWNIDVAHW-CPHVJDLKSA-N |
| XLogP | 5.00 |
| TPSA | 121.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.61 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|