C33H35FN6O3 — CID 177016122
(3S)-3-[6-[(4R)-1-[[4-(3-cyclopropyl-1,2,4-triazol-1-yl)phenyl]methyl]-4-hydroxy-3,3-dimethylpiperidin-4-yl]-5-fluoroquinolin-3-yl]piperidine-2,6-dione (PubChem CID 177016122) has the molecular formula C33H35FN6O3 and a molecular weight of 582.68 g/mol. Its IUPAC name is (3S)-3-[6-[(4R)-1-[[4-(3-cyclopropyl-1,2,4-triazol-1-yl)phenyl]methyl]-4-hydroxy-3,3-dimethylpiperidin-4-yl]-5-fluoroquinolin-3-yl]piperidine-2,6-dione.
| Compound Name | (3S)-3-[6-[(4R)-1-[[4-(3-cyclopropyl-1,2,4-triazol-1-yl)phenyl]methyl]-4-hydroxy-3,3-dimethylpiperidin-4-yl]-5-fluoroquinolin-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177016122 |
| Molecular Formula | C33H35FN6O3 |
| Molecular Weight | 582.68 g/mol |
| Exact Mass | 582.28 |
| IUPAC Name | (3S)-3-[6-[(4R)-1-[[4-(3-cyclopropyl-1,2,4-triazol-1-yl)phenyl]methyl]-4-hydroxy-3,3-dimethylpiperidin-4-yl]-5-fluoroquinolin-3-yl]piperidine-2,6-dione |
| SMILES | CC1(C)CN(Cc2ccc(-n3cnc(C4CC4)n3)cc2)CC[C@]1(O)c1ccc2ncc([C@@H]3CCC(=O)NC3=O)cc2c1F |
| InChI | InChI=1S/C33H35FN6O3/c1-32(2)18-39(17-20-3-7-23(8-4-20)40-19-36-30(38-40)21-5-6-21)14-13-33(32,43)26-10-11-27-25(29(26)34)15-22(16-35-27)24-9-12-28(41)37-31(24)42/h3-4,7-8,10-11,15-16,19,21,24,43H,5-6,9,12-14,17-18H2,1-2H3,(H,37,41,42)/t24-,33-/m0/s1 |
| InChIKey | AZKAEFRJLGGUCL-RBBQXQBVSA-N |
| XLogP | 4.47 |
| TPSA | 113.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.68 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|