C26H32FN3O5 — CID 177016082
tert-butyl 4-[3-(2,6-dioxopiperidin-3-yl)-5-fluoroquinolin-6-yl]-4-hydroxy-3,3-dimethylpiperidine-1-carboxylate (PubChem CID 177016082) has the molecular formula C26H32FN3O5 and a molecular weight of 485.56 g/mol. Its IUPAC name is tert-butyl 4-[3-(2,6-dioxopiperidin-3-yl)-5-fluoroquinolin-6-yl]-4-hydroxy-3,3-dimethylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(2,6-dioxopiperidin-3-yl)-5-fluoroquinolin-6-yl]-4-hydroxy-3,3-dimethylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 177016082 |
| Molecular Formula | C26H32FN3O5 |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | tert-butyl 4-[3-(2,6-dioxopiperidin-3-yl)-5-fluoroquinolin-6-yl]-4-hydroxy-3,3-dimethylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(O)(c2ccc3ncc(C4CCC(=O)NC4=O)cc3c2F)C(C)(C)C1 |
| InChI | InChI=1S/C26H32FN3O5/c1-24(2,3)35-23(33)30-11-10-26(34,25(4,5)14-30)18-7-8-19-17(21(18)27)12-15(13-28-19)16-6-9-20(31)29-22(16)32/h7-8,12-13,16,34H,6,9-11,14H2,1-5H3,(H,29,31,32) |
| InChIKey | BOENRSDOSJFLAX-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|