C24H28FN3O5 — CID 177017465
tert-butyl 4-[3-(2,6-dioxopiperidin-3-yl)-5-fluoroquinolin-6-yl]-4-hydroxypiperidine-1-carboxylate (PubChem CID 177017465) has the molecular formula C24H28FN3O5 and a molecular weight of 457.50 g/mol. Its IUPAC name is tert-butyl 4-[3-(2,6-dioxopiperidin-3-yl)-5-fluoroquinolin-6-yl]-4-hydroxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(2,6-dioxopiperidin-3-yl)-5-fluoroquinolin-6-yl]-4-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 177017465 |
| Molecular Formula | C24H28FN3O5 |
| Molecular Weight | 457.50 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | tert-butyl 4-[3-(2,6-dioxopiperidin-3-yl)-5-fluoroquinolin-6-yl]-4-hydroxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(O)(c2ccc3ncc(C4CCC(=O)NC4=O)cc3c2F)CC1 |
| InChI | InChI=1S/C24H28FN3O5/c1-23(2,3)33-22(31)28-10-8-24(32,9-11-28)17-5-6-18-16(20(17)25)12-14(13-26-18)15-4-7-19(29)27-21(15)30/h5-6,12-13,15,32H,4,7-11H2,1-3H3,(H,27,29,30) |
| InChIKey | UEQMASYEQHNFNO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.50 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|