C33H35FN4O4 — CID 177017369
3-[6-[(4S)-1-[[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]methyl]-4-hydroxy-3,3-dimethylpiperidin-4-yl]-5-fluoroquinolin-3-yl]piperidine-2,6-dione (PubChem CID 177017369) has the molecular formula C33H35FN4O4 and a molecular weight of 570.67 g/mol. Its IUPAC name is 3-[6-[(4S)-1-[[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]methyl]-4-hydroxy-3,3-dimethylpiperidin-4-yl]-5-fluoroquinolin-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[(4S)-1-[[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]methyl]-4-hydroxy-3,3-dimethylpiperidin-4-yl]-5-fluoroquinolin-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177017369 |
| Molecular Formula | C33H35FN4O4 |
| Molecular Weight | 570.67 g/mol |
| Exact Mass | 570.26 |
| IUPAC Name | 3-[6-[(4S)-1-[[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]methyl]-4-hydroxy-3,3-dimethylpiperidin-4-yl]-5-fluoroquinolin-3-yl]piperidine-2,6-dione |
| SMILES | Cc1noc(C)c1-c1ccc(CN2CC[C@@](O)(c3ccc4ncc(C5CCC(=O)NC5=O)cc4c3F)C(C)(C)C2)cc1 |
| InChI | InChI=1S/C33H35FN4O4/c1-19-29(20(2)42-37-19)22-7-5-21(6-8-22)17-38-14-13-33(41,32(3,4)18-38)26-10-11-27-25(30(26)34)15-23(16-35-27)24-9-12-28(39)36-31(24)40/h5-8,10-11,15-16,24,41H,9,12-14,17-18H2,1-4H3,(H,36,39,40)/t24?,33-/m1/s1 |
| InChIKey | NJMOEBQJMVAWDJ-JSYCSMLOSA-N |
| XLogP | 5.29 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.67 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|