C31H34F3N3O3 — CID 177017603
3-[6-[3-[[4-(1,1-difluoroethyl)phenyl]methyl]-1-methyl-7-oxa-3-azabicyclo[4.1.0]heptan-6-yl]-5-fluoroquinolin-3-yl]piperidine-2,6-dione;ethane (PubChem CID 177017603) has the molecular formula C31H34F3N3O3 and a molecular weight of 553.63 g/mol. Its IUPAC name is 3-[6-[3-[[4-(1,1-difluoroethyl)phenyl]methyl]-1-methyl-7-oxa-3-azabicyclo[4.1.0]heptan-6-yl]-5-fluoroquinolin-3-yl]piperidine-2,6-dione;ethane.
| Compound Name | 3-[6-[3-[[4-(1,1-difluoroethyl)phenyl]methyl]-1-methyl-7-oxa-3-azabicyclo[4.1.0]heptan-6-yl]-5-fluoroquinolin-3-yl]piperidine-2,6-dione;ethane |
|---|---|
| PubChem CID | 177017603 |
| Molecular Formula | C31H34F3N3O3 |
| Molecular Weight | 553.63 g/mol |
| Exact Mass | 553.26 |
| IUPAC Name | 3-[6-[3-[[4-(1,1-difluoroethyl)phenyl]methyl]-1-methyl-7-oxa-3-azabicyclo[4.1.0]heptan-6-yl]-5-fluoroquinolin-3-yl]piperidine-2,6-dione;ethane |
| SMILES | CC.CC(F)(F)c1ccc(CN2CCC3(c4ccc5ncc(C6CCC(=O)NC6=O)cc5c4F)OC3(C)C2)cc1 |
| InChI | InChI=1S/C29H28F3N3O3.C2H6/c1-27-16-35(15-17-3-5-19(6-4-17)28(2,31)32)12-11-29(27,38-27)22-8-9-23-21(25(22)30)13-18(14-33-23)20-7-10-24(36)34-26(20)37;1-2/h3-6,8-9,13-14,20H,7,10-12,15-16H2,1-2H3,(H,34,36,37);1-2H3 |
| InChIKey | LIWTYCOTIKTNGQ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 74.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.63 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|