C31H34B3FIN5O4 — CID 177017381
CID 177017381 (PubChem CID 177017381) has the molecular formula C31H34B3FIN5O4 and a molecular weight of 718.98 g/mol.
| Compound Name | CID 177017381 |
|---|---|
| PubChem CID | 177017381 |
| Molecular Formula | C31H34B3FIN5O4 |
| Molecular Weight | 718.98 g/mol |
| Exact Mass | 719.19 |
| IUPAC Name | — |
| SMILES | [B]C([B])(c1ccc(C(C)C)cc1)N1CCC2(c3ccc4ncc(C5CCC(=O)NC5=O)cc4c3F)OC2(C)C1.[B]I.[H]/N=C/ON |
| InChI | InChI=1S/C30H30B2FN3O3.CH4N2O.BI/c1-17(2)18-4-6-20(7-5-18)30(31,32)36-13-12-29(28(3,16-36)39-29)23-9-10-24-22(26(23)33)14-19(15-34-24)21-8-11-25(37)35-27(21)38;2-1-4-3;1-2/h4-7,9-10,14-15,17,21H,8,11-13,16H2,1-3H3,(H,35,37,38);1-2H,3H2;/b;2-1+; |
| InChIKey | SFFNIBUJQMDRAU-JITBQSAISA-N |
| XLogP | 3.84 |
| TPSA | 133.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.98 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|