C28H36FN3O4 — CID 177016999
ethane;3-[5-fluoro-6-[1-methyl-3-(oxan-4-ylmethyl)-7-oxa-3-azabicyclo[4.1.0]heptan-6-yl]quinolin-3-yl]piperidine-2,6-dione (PubChem CID 177016999) has the molecular formula C28H36FN3O4 and a molecular weight of 497.61 g/mol. Its IUPAC name is ethane;3-[5-fluoro-6-[1-methyl-3-(oxan-4-ylmethyl)-7-oxa-3-azabicyclo[4.1.0]heptan-6-yl]quinolin-3-yl]piperidine-2,6-dione.
| Compound Name | ethane;3-[5-fluoro-6-[1-methyl-3-(oxan-4-ylmethyl)-7-oxa-3-azabicyclo[4.1.0]heptan-6-yl]quinolin-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177016999 |
| Molecular Formula | C28H36FN3O4 |
| Molecular Weight | 497.61 g/mol |
| Exact Mass | 497.27 |
| IUPAC Name | ethane;3-[5-fluoro-6-[1-methyl-3-(oxan-4-ylmethyl)-7-oxa-3-azabicyclo[4.1.0]heptan-6-yl]quinolin-3-yl]piperidine-2,6-dione |
| SMILES | CC.CC12CN(CC3CCOCC3)CCC1(c1ccc3ncc(C4CCC(=O)NC4=O)cc3c1F)O2 |
| InChI | InChI=1S/C26H30FN3O4.C2H6/c1-25-15-30(14-16-6-10-33-11-7-16)9-8-26(25,34-25)20-3-4-21-19(23(20)27)12-17(13-28-21)18-2-5-22(31)29-24(18)32;1-2/h3-4,12-13,16,18H,2,5-11,14-15H2,1H3,(H,29,31,32);1-2H3 |
| InChIKey | BOKFWGZVBVPUQQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.61 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|