C32H36FN3O4 — CID 177017048
3-[6-[3-[(4-cyclopropyloxyphenyl)methyl]-1-methyl-7-oxa-3-azabicyclo[4.1.0]heptan-6-yl]-5-fluoroquinolin-3-yl]piperidine-2,6-dione;ethane (PubChem CID 177017048) has the molecular formula C32H36FN3O4 and a molecular weight of 545.66 g/mol. Its IUPAC name is 3-[6-[3-[(4-cyclopropyloxyphenyl)methyl]-1-methyl-7-oxa-3-azabicyclo[4.1.0]heptan-6-yl]-5-fluoroquinolin-3-yl]piperidine-2,6-dione;ethane.
| Compound Name | 3-[6-[3-[(4-cyclopropyloxyphenyl)methyl]-1-methyl-7-oxa-3-azabicyclo[4.1.0]heptan-6-yl]-5-fluoroquinolin-3-yl]piperidine-2,6-dione;ethane |
|---|---|
| PubChem CID | 177017048 |
| Molecular Formula | C32H36FN3O4 |
| Molecular Weight | 545.66 g/mol |
| Exact Mass | 545.27 |
| IUPAC Name | 3-[6-[3-[(4-cyclopropyloxyphenyl)methyl]-1-methyl-7-oxa-3-azabicyclo[4.1.0]heptan-6-yl]-5-fluoroquinolin-3-yl]piperidine-2,6-dione;ethane |
| SMILES | CC.CC12CN(Cc3ccc(OC4CC4)cc3)CCC1(c1ccc3ncc(C4CCC(=O)NC4=O)cc3c1F)O2 |
| InChI | InChI=1S/C30H30FN3O4.C2H6/c1-29-17-34(16-18-2-4-20(5-3-18)37-21-6-7-21)13-12-30(29,38-29)24-9-10-25-23(27(24)31)14-19(15-32-25)22-8-11-26(35)33-28(22)36;1-2/h2-5,9-10,14-15,21-22H,6-8,11-13,16-17H2,1H3,(H,33,35,36);1-2H3 |
| InChIKey | RYNJEZVYNJAASY-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.66 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|