C26H30FN5O4 — CID 177017064
ethane;3-[5-fluoro-2-methyl-6-[1-methyl-3-(1,2,4-oxadiazol-5-ylmethyl)-7-oxa-3-azabicyclo[4.1.0]heptan-6-yl]quinolin-3-yl]piperidine-2,6-dione (PubChem CID 177017064) has the molecular formula C26H30FN5O4 and a molecular weight of 495.56 g/mol. Its IUPAC name is ethane;3-[5-fluoro-2-methyl-6-[1-methyl-3-(1,2,4-oxadiazol-5-ylmethyl)-7-oxa-3-azabicyclo[4.1.0]heptan-6-yl]quinolin-3-yl]piperidine-2,6-dione.
| Compound Name | ethane;3-[5-fluoro-2-methyl-6-[1-methyl-3-(1,2,4-oxadiazol-5-ylmethyl)-7-oxa-3-azabicyclo[4.1.0]heptan-6-yl]quinolin-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177017064 |
| Molecular Formula | C26H30FN5O4 |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | ethane;3-[5-fluoro-2-methyl-6-[1-methyl-3-(1,2,4-oxadiazol-5-ylmethyl)-7-oxa-3-azabicyclo[4.1.0]heptan-6-yl]quinolin-3-yl]piperidine-2,6-dione |
| SMILES | CC.Cc1nc2ccc(C34CCN(Cc5ncno5)CC3(C)O4)c(F)c2cc1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C24H24FN5O4.C2H6/c1-13-15(14-3-6-19(31)29-22(14)32)9-16-18(28-13)5-4-17(21(16)25)24-7-8-30(11-23(24,2)34-24)10-20-26-12-27-33-20;1-2/h4-5,9,12,14H,3,6-8,10-11H2,1-2H3,(H,29,31,32);1-2H3 |
| InChIKey | BNBNJYOFQBNFCS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|