C17H18BrFN2O2 — CID 177015948
3-(6-bromo-5-fluoro-2-methylquinolin-3-yl)piperidine-2,6-dione;ethane (PubChem CID 177015948) has the molecular formula C17H18BrFN2O2 and a molecular weight of 381.25 g/mol. Its IUPAC name is 3-(6-bromo-5-fluoro-2-methylquinolin-3-yl)piperidine-2,6-dione;ethane.
| Compound Name | 3-(6-bromo-5-fluoro-2-methylquinolin-3-yl)piperidine-2,6-dione;ethane |
|---|---|
| PubChem CID | 177015948 |
| Molecular Formula | C17H18BrFN2O2 |
| Molecular Weight | 381.25 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | 3-(6-bromo-5-fluoro-2-methylquinolin-3-yl)piperidine-2,6-dione;ethane |
| SMILES | CC.Cc1nc2ccc(Br)c(F)c2cc1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C15H12BrFN2O2.C2H6/c1-7-9(8-2-5-13(20)19-15(8)21)6-10-12(18-7)4-3-11(16)14(10)17;1-2/h3-4,6,8H,2,5H2,1H3,(H,19,20,21);1-2H3 |
| InChIKey | OUIYRJTZMATFFY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.25 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|