C30H36FN3O4 — CID 177016110
tert-butyl 5-[3-(2,6-dioxopiperidin-3-yl)-5-fluoro-2-methylquinolin-6-yl]-2-azaspiro[5.5]undec-4-ene-2-carboxylate (PubChem CID 177016110) has the molecular formula C30H36FN3O4 and a molecular weight of 521.63 g/mol. Its IUPAC name is tert-butyl 5-[3-(2,6-dioxopiperidin-3-yl)-5-fluoro-2-methylquinolin-6-yl]-2-azaspiro[5.5]undec-4-ene-2-carboxylate.
| Compound Name | tert-butyl 5-[3-(2,6-dioxopiperidin-3-yl)-5-fluoro-2-methylquinolin-6-yl]-2-azaspiro[5.5]undec-4-ene-2-carboxylate |
|---|---|
| PubChem CID | 177016110 |
| Molecular Formula | C30H36FN3O4 |
| Molecular Weight | 521.63 g/mol |
| Exact Mass | 521.27 |
| IUPAC Name | tert-butyl 5-[3-(2,6-dioxopiperidin-3-yl)-5-fluoro-2-methylquinolin-6-yl]-2-azaspiro[5.5]undec-4-ene-2-carboxylate |
| SMILES | Cc1nc2ccc(C3=CCN(C(=O)OC(C)(C)C)CC34CCCCC4)c(F)c2cc1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C30H36FN3O4/c1-18-21(19-9-11-25(35)33-27(19)36)16-22-24(32-18)10-8-20(26(22)31)23-12-15-34(28(37)38-29(2,3)4)17-30(23)13-6-5-7-14-30/h8,10,12,16,19H,5-7,9,11,13-15,17H2,1-4H3,(H,33,35,36) |
| InChIKey | GRSBBVIMHPWZEK-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.63 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|