C27H35N3O5 — CID 177018212
tert-butyl 4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3,3-diethyl-2,6-dihydropyridine-1-carboxylate (PubChem CID 177018212) has the molecular formula C27H35N3O5 and a molecular weight of 481.59 g/mol. Its IUPAC name is tert-butyl 4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3,3-diethyl-2,6-dihydropyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3,3-diethyl-2,6-dihydropyridine-1-carboxylate |
|---|---|
| PubChem CID | 177018212 |
| Molecular Formula | C27H35N3O5 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | tert-butyl 4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3,3-diethyl-2,6-dihydropyridine-1-carboxylate |
| SMILES | CCC1(CC)CN(C(=O)OC(C)(C)C)CC=C1c1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C27H35N3O5/c1-6-27(7-2)16-29(25(34)35-26(3,4)5)13-12-20(27)17-8-9-19-18(14-17)15-30(24(19)33)21-10-11-22(31)28-23(21)32/h8-9,12,14,21H,6-7,10-11,13,15-16H2,1-5H3,(H,28,31,32) |
| InChIKey | BWVRIWIWSSKBAX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|