C24H32N4O5 — CID 134579791
tert-butyl (2S,6R)-4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-2,6-dimethylpiperazine-1-carboxylate (PubChem CID 134579791) has the molecular formula C24H32N4O5 and a molecular weight of 456.54 g/mol. Its IUPAC name is tert-butyl (2S,6R)-4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-2,6-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2S,6R)-4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-2,6-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 134579791 |
| Molecular Formula | C24H32N4O5 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | tert-butyl (2S,6R)-4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-2,6-dimethylpiperazine-1-carboxylate |
| SMILES | C[C@@H]1CN(c2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)C[C@H](C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H32N4O5/c1-14-11-26(12-15(2)28(14)23(32)33-24(3,4)5)17-6-7-18-16(10-17)13-27(22(18)31)19-8-9-20(29)25-21(19)30/h6-7,10,14-15,19H,8-9,11-13H2,1-5H3,(H,25,29,30)/t14-,15+,19? |
| InChIKey | AOGJEBGDQZJKCJ-RTHVDDQRSA-N |
| XLogP | 2.28 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|