C23H27N3O5 — CID 138562678
2-tert-butyl-4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3,6-dihydro-2H-pyridine-1-carboxylic acid (PubChem CID 138562678) has the molecular formula C23H27N3O5 and a molecular weight of 425.49 g/mol. Its IUPAC name is 2-tert-butyl-4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3,6-dihydro-2H-pyridine-1-carboxylic acid.
| Compound Name | 2-tert-butyl-4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3,6-dihydro-2H-pyridine-1-carboxylic acid |
|---|---|
| PubChem CID | 138562678 |
| Molecular Formula | C23H27N3O5 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 2-tert-butyl-4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3,6-dihydro-2H-pyridine-1-carboxylic acid |
| SMILES | CC(C)(C)C1CC(c2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)=CCN1C(=O)O |
| InChI | InChI=1S/C23H27N3O5/c1-23(2,3)18-11-14(8-9-25(18)22(30)31)13-4-5-16-15(10-13)12-26(21(16)29)17-6-7-19(27)24-20(17)28/h4-5,8,10,17-18H,6-7,9,11-12H2,1-3H3,(H,30,31)(H,24,27,28) |
| InChIKey | ITDOKXPDKVQVQK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|