C30H33N3O3 — CID 177017772
3-[3-oxo-6-[1-(1-phenylcyclohexyl)-3,6-dihydro-2H-pyridin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 177017772) has the molecular formula C30H33N3O3 and a molecular weight of 483.61 g/mol. Its IUPAC name is 3-[3-oxo-6-[1-(1-phenylcyclohexyl)-3,6-dihydro-2H-pyridin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-6-[1-(1-phenylcyclohexyl)-3,6-dihydro-2H-pyridin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177017772 |
| Molecular Formula | C30H33N3O3 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | 3-[3-oxo-6-[1-(1-phenylcyclohexyl)-3,6-dihydro-2H-pyridin-4-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(C4=CCN(C5(c6ccccc6)CCCCC5)CC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C30H33N3O3/c34-27-12-11-26(28(35)31-27)33-20-23-19-22(9-10-25(23)29(33)36)21-13-17-32(18-14-21)30(15-5-2-6-16-30)24-7-3-1-4-8-24/h1,3-4,7-10,13,19,26H,2,5-6,11-12,14-18,20H2,(H,31,34,35) |
| InChIKey | XFDKDCRUVMHRHG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|