About 3-(7-hydroxy-2-methylquinolin-3-yl)piperidine-2,6-dione
3-(7-hydroxy-2-methylquinolin-3-yl)piperidine-2,6-dione (PubChem CID 166151987) has the molecular formula C15H14N2O3
and a molecular weight of 270.29 g/mol. Its IUPAC name is 3-(7-hydroxy-2-methylquinolin-3-yl)piperidine-2,6-dione.
Molecular Properties
| Compound Name | 3-(7-hydroxy-2-methylquinolin-3-yl)piperidine-2,6-dione |
| PubChem CID | 166151987 |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 3-(7-hydroxy-2-methylquinolin-3-yl)piperidine-2,6-dione |
| SMILES | Cc1nc2cc(O)ccc2cc1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C15H14N2O3/c1-8-12(11-4-5-14(19)17-15(11)20)6-9-2-3-10(18)7-13(9)16-8/h2-3,6-7,11,18H,4-5H2,1H3,(H,17,19,20) |
| InChIKey | XBLLYASYIKPCBM-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-(7-hydroxy-2-methylquinolin-3-yl)piperidine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(7-hydroxy-2-methylquinolin-3-yl)piperidine-2,6-dione?
The IUPAC name of 3-(7-hydroxy-2-methylquinolin-3-yl)piperidine-2,6-dione (CID 166151987) is 3-(7-hydroxy-2-methylquinolin-3-yl)piperidine-2,6-dione.
What is the SMILES notation for 3-(7-hydroxy-2-methylquinolin-3-yl)piperidine-2,6-dione?
The canonical SMILES for 3-(7-hydroxy-2-methylquinolin-3-yl)piperidine-2,6-dione is Cc1nc2cc(O)ccc2cc1C1CCC(=O)NC1=O.
What is the InChIKey of 3-(7-hydroxy-2-methylquinolin-3-yl)piperidine-2,6-dione?
The InChIKey is XBLLYASYIKPCBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O3/c1-8-12(11-4-5-14(19)17-15(11)20)6-9-2-3-10(18)7-13(9)16-8/h2-3,6-7,11,18H,4-5H2,1H3,(H,17,19,20).
What are the key properties of 3-(7-hydroxy-2-methylquinolin-3-yl)piperidine-2,6-dione?
3-(7-hydroxy-2-methylquinolin-3-yl)piperidine-2,6-dione has a molecular weight of 270.29 g/mol, XLogP of 1.77, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(7-hydroxy-2-methylquinolin-3-yl)piperidine-2,6-dione is sourced from PubChem (CID 166151987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).