C25H31N3O5 — CID 177017144
tert-butyl 4-[3-(2,6-dioxopiperidin-3-yl)-8-methylquinolin-6-yl]-4-hydroxypiperidine-1-carboxylate (PubChem CID 177017144) has the molecular formula C25H31N3O5 and a molecular weight of 453.54 g/mol. Its IUPAC name is tert-butyl 4-[3-(2,6-dioxopiperidin-3-yl)-8-methylquinolin-6-yl]-4-hydroxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(2,6-dioxopiperidin-3-yl)-8-methylquinolin-6-yl]-4-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 177017144 |
| Molecular Formula | C25H31N3O5 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | tert-butyl 4-[3-(2,6-dioxopiperidin-3-yl)-8-methylquinolin-6-yl]-4-hydroxypiperidine-1-carboxylate |
| SMILES | Cc1cc(C2(O)CCN(C(=O)OC(C)(C)C)CC2)cc2cc(C3CCC(=O)NC3=O)cnc12 |
| InChI | InChI=1S/C25H31N3O5/c1-15-11-18(25(32)7-9-28(10-8-25)23(31)33-24(2,3)4)13-16-12-17(14-26-21(15)16)19-5-6-20(29)27-22(19)30/h11-14,19,32H,5-10H2,1-4H3,(H,27,29,30) |
| InChIKey | GOVFDTPKZZNUIP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|