C29H29FN6O4 — CID 177016097
1-[5-fluoro-6-[(4S)-4-hydroxy-3,3-dimethyl-1-[[4-(1,2,4-oxadiazol-3-yl)phenyl]methyl]piperidin-4-yl]quinolin-3-yl]-1,3-diazinane-2,4-dione (PubChem CID 177016097) has the molecular formula C29H29FN6O4 and a molecular weight of 544.59 g/mol. Its IUPAC name is 1-[5-fluoro-6-[(4S)-4-hydroxy-3,3-dimethyl-1-[[4-(1,2,4-oxadiazol-3-yl)phenyl]methyl]piperidin-4-yl]quinolin-3-yl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[5-fluoro-6-[(4S)-4-hydroxy-3,3-dimethyl-1-[[4-(1,2,4-oxadiazol-3-yl)phenyl]methyl]piperidin-4-yl]quinolin-3-yl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 177016097 |
| Molecular Formula | C29H29FN6O4 |
| Molecular Weight | 544.59 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | 1-[5-fluoro-6-[(4S)-4-hydroxy-3,3-dimethyl-1-[[4-(1,2,4-oxadiazol-3-yl)phenyl]methyl]piperidin-4-yl]quinolin-3-yl]-1,3-diazinane-2,4-dione |
| SMILES | CC1(C)CN(Cc2ccc(-c3ncon3)cc2)CC[C@@]1(O)c1ccc2ncc(N3CCC(=O)NC3=O)cc2c1F |
| InChI | InChI=1S/C29H29FN6O4/c1-28(2)16-35(15-18-3-5-19(6-4-18)26-32-17-40-34-26)12-10-29(28,39)22-7-8-23-21(25(22)30)13-20(14-31-23)36-11-9-24(37)33-27(36)38/h3-8,13-14,17,39H,9-12,15-16H2,1-2H3,(H,33,37,38)/t29-/m1/s1 |
| InChIKey | XYWDRMUBAUVMGU-GDLZYMKVSA-N |
| XLogP | 3.99 |
| TPSA | 124.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.59 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |