C29H28ClFN6O4 — CID 177016262
1-[6-[(4R)-1-[[3-chloro-4-(1,3,4-oxadiazol-2-yl)phenyl]methyl]-4-hydroxy-3,3-dimethylpiperidin-4-yl]-5-fluoroquinolin-3-yl]-1,3-diazinane-2,4-dione (PubChem CID 177016262) has the molecular formula C29H28ClFN6O4 and a molecular weight of 579.03 g/mol. Its IUPAC name is 1-[6-[(4R)-1-[[3-chloro-4-(1,3,4-oxadiazol-2-yl)phenyl]methyl]-4-hydroxy-3,3-dimethylpiperidin-4-yl]-5-fluoroquinolin-3-yl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[6-[(4R)-1-[[3-chloro-4-(1,3,4-oxadiazol-2-yl)phenyl]methyl]-4-hydroxy-3,3-dimethylpiperidin-4-yl]-5-fluoroquinolin-3-yl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 177016262 |
| Molecular Formula | C29H28ClFN6O4 |
| Molecular Weight | 579.03 g/mol |
| Exact Mass | 578.18 |
| IUPAC Name | 1-[6-[(4R)-1-[[3-chloro-4-(1,3,4-oxadiazol-2-yl)phenyl]methyl]-4-hydroxy-3,3-dimethylpiperidin-4-yl]-5-fluoroquinolin-3-yl]-1,3-diazinane-2,4-dione |
| SMILES | CC1(C)CN(Cc2ccc(-c3nnco3)c(Cl)c2)CC[C@]1(O)c1ccc2ncc(N3CCC(=O)NC3=O)cc2c1F |
| InChI | InChI=1S/C29H28ClFN6O4/c1-28(2)15-36(14-17-3-4-19(22(30)11-17)26-35-33-16-41-26)10-8-29(28,40)21-5-6-23-20(25(21)31)12-18(13-32-23)37-9-7-24(38)34-27(37)39/h3-6,11-13,16,40H,7-10,14-15H2,1-2H3,(H,34,38,39)/t29-/m0/s1 |
| InChIKey | WYXXOMOHEPSEFC-LJAQVGFWSA-N |
| XLogP | 4.64 |
| TPSA | 124.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.03 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |