C27H37N3O3 — CID 177016735
3-[6-(1-ethyl-4-hydroxy-3,3-dipropylpiperidin-4-yl)quinolin-3-yl]piperidine-2,6-dione (PubChem CID 177016735) has the molecular formula C27H37N3O3 and a molecular weight of 451.61 g/mol. Its IUPAC name is 3-[6-(1-ethyl-4-hydroxy-3,3-dipropylpiperidin-4-yl)quinolin-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-(1-ethyl-4-hydroxy-3,3-dipropylpiperidin-4-yl)quinolin-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177016735 |
| Molecular Formula | C27H37N3O3 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.28 |
| IUPAC Name | 3-[6-(1-ethyl-4-hydroxy-3,3-dipropylpiperidin-4-yl)quinolin-3-yl]piperidine-2,6-dione |
| SMILES | CCCC1(CCC)CN(CC)CCC1(O)c1ccc2ncc(C3CCC(=O)NC3=O)cc2c1 |
| InChI | InChI=1S/C27H37N3O3/c1-4-11-26(12-5-2)18-30(6-3)14-13-27(26,33)21-7-9-23-19(16-21)15-20(17-28-23)22-8-10-24(31)29-25(22)32/h7,9,15-17,22,33H,4-6,8,10-14,18H2,1-3H3,(H,29,31,32) |
| InChIKey | UQHZUPOCRGXVBM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|