C27H26F3N3O3 — CID 177016029
3-[6-[4-hydroxy-1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]quinolin-3-yl]piperidine-2,6-dione (PubChem CID 177016029) has the molecular formula C27H26F3N3O3 and a molecular weight of 497.52 g/mol. Its IUPAC name is 3-[6-[4-hydroxy-1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]quinolin-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-hydroxy-1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]quinolin-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177016029 |
| Molecular Formula | C27H26F3N3O3 |
| Molecular Weight | 497.52 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | 3-[6-[4-hydroxy-1-[[4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]quinolin-3-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(c2cnc3ccc(C4(O)CCN(Cc5ccc(C(F)(F)F)cc5)CC4)cc3c2)C(=O)N1 |
| InChI | InChI=1S/C27H26F3N3O3/c28-27(29,30)20-3-1-17(2-4-20)16-33-11-9-26(36,10-12-33)21-5-7-23-18(14-21)13-19(15-31-23)22-6-8-24(34)32-25(22)35/h1-5,7,13-15,22,36H,6,8-12,16H2,(H,32,34,35) |
| InChIKey | RPOUYVDYJZWLDO-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.52 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|