C27H30BN3O3 — CID 177017586
4-[3-(2,6-dioxopiperidin-3-yl)quinolin-6-yl]-3-[(2E,4Z)-hepta-2,4-dien-3-yl]-4-hydroxyborinane-1-carbonitrile (PubChem CID 177017586) has the molecular formula C27H30BN3O3 and a molecular weight of 455.37 g/mol. Its IUPAC name is 4-[3-(2,6-dioxopiperidin-3-yl)quinolin-6-yl]-3-[(2E,4Z)-hepta-2,4-dien-3-yl]-4-hydroxyborinane-1-carbonitrile.
| Compound Name | 4-[3-(2,6-dioxopiperidin-3-yl)quinolin-6-yl]-3-[(2E,4Z)-hepta-2,4-dien-3-yl]-4-hydroxyborinane-1-carbonitrile |
|---|---|
| PubChem CID | 177017586 |
| Molecular Formula | C27H30BN3O3 |
| Molecular Weight | 455.37 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | 4-[3-(2,6-dioxopiperidin-3-yl)quinolin-6-yl]-3-[(2E,4Z)-hepta-2,4-dien-3-yl]-4-hydroxyborinane-1-carbonitrile |
| SMILES | C/C=C(\C=C/CC)C1CB(C#N)CCC1(O)c1ccc2ncc(C3CCC(=O)NC3=O)cc2c1 |
| InChI | InChI=1S/C27H30BN3O3/c1-3-5-6-18(4-2)23-15-28(17-29)12-11-27(23,34)21-7-9-24-19(14-21)13-20(16-30-24)22-8-10-25(32)31-26(22)33/h4-7,9,13-14,16,22-23,34H,3,8,10-12,15H2,1-2H3,(H,31,32,33)/b6-5-,18-4+ |
| InChIKey | VBHNYYIIDQJFFP-BSXFWRJSSA-N |
| XLogP | 4.43 |
| TPSA | 103.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.37 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|