C16H18N2O2S — CID 170132903
3-(4-tert-butyl-1,3-benzothiazol-2-yl)piperidine-2,6-dione (PubChem CID 170132903) has the molecular formula C16H18N2O2S and a molecular weight of 302.40 g/mol. Its IUPAC name is 3-(4-tert-butyl-1,3-benzothiazol-2-yl)piperidine-2,6-dione.
| Compound Name | 3-(4-tert-butyl-1,3-benzothiazol-2-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 170132903 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 3-(4-tert-butyl-1,3-benzothiazol-2-yl)piperidine-2,6-dione |
| SMILES | CC(C)(C)c1cccc2sc(C3CCC(=O)NC3=O)nc12 |
| InChI | InChI=1S/C16H18N2O2S/c1-16(2,3)10-5-4-6-11-13(10)18-15(21-11)9-7-8-12(19)17-14(9)20/h4-6,9H,7-8H2,1-3H3,(H,17,19,20) |
| InChIKey | QLLJOJWZZJVRGX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|