C14H15ClN2O3 — CID 170904716
3-[6-(aminomethyl)-1-benzofuran-3-yl]piperidine-2,6-dione;hydrochloride (PubChem CID 170904716) has the molecular formula C14H15ClN2O3 and a molecular weight of 294.74 g/mol. Its IUPAC name is 3-[6-(aminomethyl)-1-benzofuran-3-yl]piperidine-2,6-dione;hydrochloride.
| Compound Name | 3-[6-(aminomethyl)-1-benzofuran-3-yl]piperidine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 170904716 |
| Molecular Formula | C14H15ClN2O3 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 3-[6-(aminomethyl)-1-benzofuran-3-yl]piperidine-2,6-dione;hydrochloride |
| SMILES | Cl.NCc1ccc2c(C3CCC(=O)NC3=O)coc2c1 |
| InChI | InChI=1S/C14H14N2O3.ClH/c15-6-8-1-2-9-11(7-19-12(9)5-8)10-3-4-13(17)16-14(10)18;/h1-2,5,7,10H,3-4,6,15H2,(H,16,17,18);1H |
| InChIKey | RZMUBRYQHJYQEO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|