C16H12N2O3 — CID 158104093
(3R)-3-furo[3,2-g]quinolin-3-ylpiperidine-2,6-dione (PubChem CID 158104093) has the molecular formula C16H12N2O3 and a molecular weight of 280.28 g/mol. Its IUPAC name is (3R)-3-furo[3,2-g]quinolin-3-ylpiperidine-2,6-dione.
| Compound Name | (3R)-3-furo[3,2-g]quinolin-3-ylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 158104093 |
| Molecular Formula | C16H12N2O3 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | (3R)-3-furo[3,2-g]quinolin-3-ylpiperidine-2,6-dione |
| SMILES | O=C1CC[C@H](c2coc3cc4ncccc4cc23)C(=O)N1 |
| InChI | InChI=1S/C16H12N2O3/c19-15-4-3-10(16(20)18-15)12-8-21-14-7-13-9(6-11(12)14)2-1-5-17-13/h1-2,5-8,10H,3-4H2,(H,18,19,20)/t10-/m1/s1 |
| InChIKey | ZSICPMVUZJKUHF-SNVBAGLBSA-N |
| XLogP | 2.50 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|