C15H10FNO3 — CID 176508907
3-(6-ethynyl-4-fluoro-1-benzofuran-3-yl)piperidine-2,6-dione (PubChem CID 176508907) has the molecular formula C15H10FNO3 and a molecular weight of 271.25 g/mol. Its IUPAC name is 3-(6-ethynyl-4-fluoro-1-benzofuran-3-yl)piperidine-2,6-dione.
| Compound Name | 3-(6-ethynyl-4-fluoro-1-benzofuran-3-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 176508907 |
| Molecular Formula | C15H10FNO3 |
| Molecular Weight | 271.25 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 3-(6-ethynyl-4-fluoro-1-benzofuran-3-yl)piperidine-2,6-dione |
| SMILES | C#Cc1cc(F)c2c(C3CCC(=O)NC3=O)coc2c1 |
| InChI | InChI=1S/C15H10FNO3/c1-2-8-5-11(16)14-10(7-20-12(14)6-8)9-3-4-13(18)17-15(9)19/h1,5-7,9H,3-4H2,(H,17,18,19) |
| InChIKey | SNKNLKLYBSKJAE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|