C14H27N3O2 — CID 171565054
ethane;N'-(2-methylprop-1-enyl)-2,6-dioxopiperidine-3-carboximidamide (PubChem CID 171565054) has the molecular formula C14H27N3O2 and a molecular weight of 269.39 g/mol. Its IUPAC name is ethane;N'-(2-methylprop-1-enyl)-2,6-dioxopiperidine-3-carboximidamide.
| Compound Name | ethane;N'-(2-methylprop-1-enyl)-2,6-dioxopiperidine-3-carboximidamide |
|---|---|
| PubChem CID | 171565054 |
| Molecular Formula | C14H27N3O2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | ethane;N'-(2-methylprop-1-enyl)-2,6-dioxopiperidine-3-carboximidamide |
| SMILES | CC.CC.CC(C)=C/N=C(\N)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C10H15N3O2.2C2H6/c1-6(2)5-12-9(11)7-3-4-8(14)13-10(7)15;2*1-2/h5,7H,3-4H2,1-2H3,(H2,11,12)(H,13,14,15);2*1-2H3 |
| InChIKey | AHJBPYAGYDFDQW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|