C10H14N2O3 — CID 176899722
1-(2,6-dioxopiperidin-3-yl)cyclobutane-1-carboxamide (PubChem CID 176899722) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 1-(2,6-dioxopiperidin-3-yl)cyclobutane-1-carboxamide.
| Compound Name | 1-(2,6-dioxopiperidin-3-yl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 176899722 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 1-(2,6-dioxopiperidin-3-yl)cyclobutane-1-carboxamide |
| SMILES | NC(=O)C1(C2CCC(=O)NC2=O)CCC1 |
| InChI | InChI=1S/C10H14N2O3/c11-9(15)10(4-1-5-10)6-2-3-7(13)12-8(6)14/h6H,1-5H2,(H2,11,15)(H,12,13,14) |
| InChIKey | XLVHLTYWQLSQDF-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|