C5H9ClN2O2 — CID 162343638
(3R)-3-amino-3-deuteriopiperidine-2,6-dione;hydrochloride (PubChem CID 162343638) has the molecular formula C5H9ClN2O2 and a molecular weight of 165.60 g/mol. Its IUPAC name is (3R)-3-amino-3-deuteriopiperidine-2,6-dione;hydrochloride.
| Compound Name | (3R)-3-amino-3-deuteriopiperidine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 162343638 |
| Molecular Formula | C5H9ClN2O2 |
| Molecular Weight | 165.60 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | (3R)-3-amino-3-deuteriopiperidine-2,6-dione;hydrochloride |
| SMILES | Cl.[2H][C@@]1(N)CCC(=O)NC1=O |
| InChI | InChI=1S/C5H8N2O2.ClH/c6-3-1-2-4(8)7-5(3)9;/h3H,1-2,6H2,(H,7,8,9);1H/t3-;/m1./s1/i3D; |
| InChIKey | YCPULGHBTPQLRH-MNJVLTPPSA-N |
| XLogP | -0.83 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.60 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|