C8H9NO3 — CID 67066617
3-(2-methylprop-2-enoyl)pyrrolidine-2,5-dione (PubChem CID 67066617) has the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. Its IUPAC name is 3-(2-methylprop-2-enoyl)pyrrolidine-2,5-dione.
| Compound Name | 3-(2-methylprop-2-enoyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 67066617 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | 3-(2-methylprop-2-enoyl)pyrrolidine-2,5-dione |
| SMILES | C=C(C)C(=O)C1CC(=O)NC1=O |
| InChI | InChI=1S/C8H9NO3/c1-4(2)7(11)5-3-6(10)9-8(5)12/h5H,1,3H2,2H3,(H,9,10,12) |
| InChIKey | FLCHTFNOXYTTDK-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|