C6H8INO4 — CID 158302570
(2,5-dioxopyrrolidin-3-yl) acetate;hydroiodide (PubChem CID 158302570) has the molecular formula C6H8INO4 and a molecular weight of 285.04 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-3-yl) acetate;hydroiodide.
| Compound Name | (2,5-dioxopyrrolidin-3-yl) acetate;hydroiodide |
|---|---|
| PubChem CID | 158302570 |
| Molecular Formula | C6H8INO4 |
| Molecular Weight | 285.04 g/mol |
| Exact Mass | 284.95 |
| IUPAC Name | (2,5-dioxopyrrolidin-3-yl) acetate;hydroiodide |
| SMILES | CC(=O)OC1CC(=O)NC1=O.I |
| InChI | InChI=1S/C6H7NO4.HI/c1-3(8)11-4-2-5(9)7-6(4)10;/h4H,2H2,1H3,(H,7,9,10);1H |
| InChIKey | AVORCXQDZHHRHB-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.04 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|