C4H5NO4 — CID 141263831
3-hydroperoxypyrrolidine-2,5-dione (PubChem CID 141263831) has the molecular formula C4H5NO4 and a molecular weight of 131.09 g/mol. Its IUPAC name is 3-hydroperoxypyrrolidine-2,5-dione.
| Compound Name | 3-hydroperoxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 141263831 |
| Molecular Formula | C4H5NO4 |
| Molecular Weight | 131.09 g/mol |
| Exact Mass | 131.02 |
| IUPAC Name | 3-hydroperoxypyrrolidine-2,5-dione |
| SMILES | O=C1CC(OO)C(=O)N1 |
| InChI | InChI=1S/C4H5NO4/c6-3-1-2(9-8)4(7)5-3/h2,8H,1H2,(H,5,6,7) |
| InChIKey | MERDJMUVRYIPEF-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.09 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|