C4H5NNaO3 — CID 66653042
CID 66653042 (PubChem CID 66653042) has the molecular formula C4H5NNaO3 and a molecular weight of 138.08 g/mol.
| Compound Name | CID 66653042 |
|---|---|
| PubChem CID | 66653042 |
| Molecular Formula | C4H5NNaO3 |
| Molecular Weight | 138.08 g/mol |
| Exact Mass | 138.02 |
| IUPAC Name | — |
| SMILES | O=C1CC(O)C(=O)N1.[Na] |
| InChI | InChI=1S/C4H5NO3.Na/c6-2-1-3(7)5-4(2)8;/h2,6H,1H2,(H,5,7,8); |
| InChIKey | WHHZSVQZOFCFHL-UHFFFAOYSA-N |
| XLogP | -1.99 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.08 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|