C14H27NO7 — CID 122537613
1-hydroperoxyperoxydecane;3-hydroxypyrrolidine-2,5-dione (PubChem CID 122537613) has the molecular formula C14H27NO7 and a molecular weight of 321.37 g/mol. Its IUPAC name is 1-hydroperoxyperoxydecane;3-hydroxypyrrolidine-2,5-dione.
| Compound Name | 1-hydroperoxyperoxydecane;3-hydroxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 122537613 |
| Molecular Formula | C14H27NO7 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 1-hydroperoxyperoxydecane;3-hydroxypyrrolidine-2,5-dione |
| SMILES | CCCCCCCCCCOOOO.O=C1CC(O)C(=O)N1 |
| InChI | InChI=1S/C10H22O4.C4H5NO3/c1-2-3-4-5-6-7-8-9-10-12-14-13-11;6-2-1-3(7)5-4(2)8/h11H,2-10H2,1H3;2,6H,1H2,(H,5,7,8) |
| InChIKey | BLLSQPRIIBLUSO-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|