About ethane-1,2-diol;3-hydroxypyrrolidine-2,5-dione
ethane-1,2-diol;3-hydroxypyrrolidine-2,5-dione (PubChem CID 118323110) has the molecular formula C6H11NO5
and a molecular weight of 177.16 g/mol. Its IUPAC name is ethane-1,2-diol;3-hydroxypyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | ethane-1,2-diol;3-hydroxypyrrolidine-2,5-dione |
| PubChem CID | 118323110 |
| Molecular Formula | C6H11NO5 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | ethane-1,2-diol;3-hydroxypyrrolidine-2,5-dione |
| SMILES | O=C1CC(O)C(=O)N1.OCCO |
| InChI | InChI=1S/C4H5NO3.C2H6O2/c6-2-1-3(7)5-4(2)8;3-1-2-4/h2,6H,1H2,(H,5,7,8);3-4H,1-2H2 |
| InChIKey | YYRHRBSXTHCTKL-UHFFFAOYSA-N |
| XLogP | -2.64 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze ethane-1,2-diol;3-hydroxypyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane-1,2-diol;3-hydroxypyrrolidine-2,5-dione?
The IUPAC name of ethane-1,2-diol;3-hydroxypyrrolidine-2,5-dione (CID 118323110) is ethane-1,2-diol;3-hydroxypyrrolidine-2,5-dione.
What is the SMILES notation for ethane-1,2-diol;3-hydroxypyrrolidine-2,5-dione?
The canonical SMILES for ethane-1,2-diol;3-hydroxypyrrolidine-2,5-dione is O=C1CC(O)C(=O)N1.OCCO.
What is the InChIKey of ethane-1,2-diol;3-hydroxypyrrolidine-2,5-dione?
The InChIKey is YYRHRBSXTHCTKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO3.C2H6O2/c6-2-1-3(7)5-4(2)8;3-1-2-4/h2,6H,1H2,(H,5,7,8);3-4H,1-2H2.
What are the key properties of ethane-1,2-diol;3-hydroxypyrrolidine-2,5-dione?
ethane-1,2-diol;3-hydroxypyrrolidine-2,5-dione has a molecular weight of 177.16 g/mol, XLogP of -2.64, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane-1,2-diol;3-hydroxypyrrolidine-2,5-dione is sourced from PubChem (CID 118323110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).