C6H11NO5 — CID 118323110
ethane-1,2-diol;3-hydroxypyrrolidine-2,5-dione (PubChem CID 118323110) has the molecular formula C6H11NO5 and a molecular weight of 177.16 g/mol. Its IUPAC name is ethane-1,2-diol;3-hydroxypyrrolidine-2,5-dione.
| Compound Name | ethane-1,2-diol;3-hydroxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 118323110 |
| Molecular Formula | C6H11NO5 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | ethane-1,2-diol;3-hydroxypyrrolidine-2,5-dione |
| SMILES | O=C1CC(O)C(=O)N1.OCCO |
| InChI | InChI=1S/C4H5NO3.C2H6O2/c6-2-1-3(7)5-4(2)8;3-1-2-4/h2,6H,1H2,(H,5,7,8);3-4H,1-2H2 |
| InChIKey | YYRHRBSXTHCTKL-UHFFFAOYSA-N |
| XLogP | -2.64 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|