C12H20N2O6S — CID 87404636
(2R)-2-(2,2-dimethylpropanoylamino)-3-sulfanylpropanoic acid;3-hydroxypyrrolidine-2,5-dione (PubChem CID 87404636) has the molecular formula C12H20N2O6S and a molecular weight of 320.37 g/mol. Its IUPAC name is (2R)-2-(2,2-dimethylpropanoylamino)-3-sulfanylpropanoic acid;3-hydroxypyrrolidine-2,5-dione.
| Compound Name | (2R)-2-(2,2-dimethylpropanoylamino)-3-sulfanylpropanoic acid;3-hydroxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 87404636 |
| Molecular Formula | C12H20N2O6S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | (2R)-2-(2,2-dimethylpropanoylamino)-3-sulfanylpropanoic acid;3-hydroxypyrrolidine-2,5-dione |
| SMILES | CC(C)(C)C(=O)N[C@@H](CS)C(=O)O.O=C1CC(O)C(=O)N1 |
| InChI | InChI=1S/C8H15NO3S.C4H5NO3/c1-8(2,3)7(12)9-5(4-13)6(10)11;6-2-1-3(7)5-4(2)8/h5,13H,4H2,1-3H3,(H,9,12)(H,10,11);2,6H,1H2,(H,5,7,8)/t5-;/m0./s1 |
| InChIKey | PHGISNFXTBSOJV-JEDNCBNOSA-N |
| XLogP | -1.07 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|