C18H24N2O7 — CID 77293508
2-(2,2-dimethylpropanoylamino)-3-(4-hydroxyphenyl)propanoic acid;3-hydroxypyrrolidine-2,5-dione (PubChem CID 77293508) has the molecular formula C18H24N2O7 and a molecular weight of 380.40 g/mol. Its IUPAC name is 2-(2,2-dimethylpropanoylamino)-3-(4-hydroxyphenyl)propanoic acid;3-hydroxypyrrolidine-2,5-dione.
| Compound Name | 2-(2,2-dimethylpropanoylamino)-3-(4-hydroxyphenyl)propanoic acid;3-hydroxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 77293508 |
| Molecular Formula | C18H24N2O7 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 2-(2,2-dimethylpropanoylamino)-3-(4-hydroxyphenyl)propanoic acid;3-hydroxypyrrolidine-2,5-dione |
| SMILES | CC(C)(C)C(=O)NC(Cc1ccc(O)cc1)C(=O)O.O=C1CC(O)C(=O)N1 |
| InChI | InChI=1S/C14H19NO4.C4H5NO3/c1-14(2,3)13(19)15-11(12(17)18)8-9-4-6-10(16)7-5-9;6-2-1-3(7)5-4(2)8/h4-7,11,16H,8H2,1-3H3,(H,15,19)(H,17,18);2,6H,1H2,(H,5,7,8) |
| InChIKey | AFZQIMCJSKQTBT-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 153.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|