C8H14N2O5 — CID 172855490
azane;3-hydroxypyrrolidine-2,5-dione;2-methylprop-2-enoic acid (PubChem CID 172855490) has the molecular formula C8H14N2O5 and a molecular weight of 218.21 g/mol. Its IUPAC name is azane;3-hydroxypyrrolidine-2,5-dione;2-methylprop-2-enoic acid.
| Compound Name | azane;3-hydroxypyrrolidine-2,5-dione;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 172855490 |
| Molecular Formula | C8H14N2O5 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | azane;3-hydroxypyrrolidine-2,5-dione;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.N.O=C1CC(O)C(=O)N1 |
| InChI | InChI=1S/C4H5NO3.C4H6O2.H3N/c6-2-1-3(7)5-4(2)8;1-3(2)4(5)6;/h2,6H,1H2,(H,5,7,8);1H2,2H3,(H,5,6);1H3 |
| InChIKey | IEXJICOYXVFMJZ-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 138.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|