About 2-methylprop-2-enoic acid;5-methylpyrrolidin-2-one
2-methylprop-2-enoic acid;5-methylpyrrolidin-2-one (PubChem CID 69307540) has the molecular formula C9H15NO3
and a molecular weight of 185.22 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;5-methylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 2-methylprop-2-enoic acid;5-methylpyrrolidin-2-one |
| PubChem CID | 69307540 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | 2-methylprop-2-enoic acid;5-methylpyrrolidin-2-one |
| SMILES | C=C(C)C(=O)O.CC1CCC(=O)N1 |
| InChI | InChI=1S/C5H9NO.C4H6O2/c1-4-2-3-5(7)6-4;1-3(2)4(5)6/h4H,2-3H2,1H3,(H,6,7);1H2,2H3,(H,5,6) |
| InChIKey | JJLVSMLZXDURQF-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enoic acid;5-methylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enoic acid;5-methylpyrrolidin-2-one?
The IUPAC name of 2-methylprop-2-enoic acid;5-methylpyrrolidin-2-one (CID 69307540) is 2-methylprop-2-enoic acid;5-methylpyrrolidin-2-one.
What is the SMILES notation for 2-methylprop-2-enoic acid;5-methylpyrrolidin-2-one?
The canonical SMILES for 2-methylprop-2-enoic acid;5-methylpyrrolidin-2-one is C=C(C)C(=O)O.CC1CCC(=O)N1.
What is the InChIKey of 2-methylprop-2-enoic acid;5-methylpyrrolidin-2-one?
The InChIKey is JJLVSMLZXDURQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO.C4H6O2/c1-4-2-3-5(7)6-4;1-3(2)4(5)6/h4H,2-3H2,1H3,(H,6,7);1H2,2H3,(H,5,6).
What are the key properties of 2-methylprop-2-enoic acid;5-methylpyrrolidin-2-one?
2-methylprop-2-enoic acid;5-methylpyrrolidin-2-one has a molecular weight of 185.22 g/mol, XLogP of 0.93, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enoic acid;5-methylpyrrolidin-2-one is sourced from PubChem (CID 69307540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).