About 6-methylpiperidin-2-one;propane
6-methylpiperidin-2-one;propane (PubChem CID 142225224) has the molecular formula C9H19NO
and a molecular weight of 157.26 g/mol. Its IUPAC name is 6-methylpiperidin-2-one;propane.
Molecular Properties
| Compound Name | 6-methylpiperidin-2-one;propane |
| PubChem CID | 142225224 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | 6-methylpiperidin-2-one;propane |
| SMILES | CC1CCCC(=O)N1.CCC |
| InChI | InChI=1S/C6H11NO.C3H8/c1-5-3-2-4-6(8)7-5;1-3-2/h5H,2-4H2,1H3,(H,7,8);3H2,1-2H3 |
| InChIKey | XZWGXSUPDUEPIF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-methylpiperidin-2-one;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylpiperidin-2-one;propane?
The IUPAC name of 6-methylpiperidin-2-one;propane (CID 142225224) is 6-methylpiperidin-2-one;propane.
What is the SMILES notation for 6-methylpiperidin-2-one;propane?
The canonical SMILES for 6-methylpiperidin-2-one;propane is CC1CCCC(=O)N1.CCC.
What is the InChIKey of 6-methylpiperidin-2-one;propane?
The InChIKey is XZWGXSUPDUEPIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO.C3H8/c1-5-3-2-4-6(8)7-5;1-3-2/h5H,2-4H2,1H3,(H,7,8);3H2,1-2H3.
What are the key properties of 6-methylpiperidin-2-one;propane?
6-methylpiperidin-2-one;propane has a molecular weight of 157.26 g/mol, XLogP of 2.09, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylpiperidin-2-one;propane is sourced from PubChem (CID 142225224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).