C20H30N2O3 — CID 159724380
1-[(4-methoxyphenyl)methyl]-6-methylpiperidin-2-one;6-methylpiperidin-2-one (PubChem CID 159724380) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-6-methylpiperidin-2-one;6-methylpiperidin-2-one.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-6-methylpiperidin-2-one;6-methylpiperidin-2-one |
|---|---|
| PubChem CID | 159724380 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-6-methylpiperidin-2-one;6-methylpiperidin-2-one |
| SMILES | CC1CCCC(=O)N1.COc1ccc(CN2C(=O)CCCC2C)cc1 |
| InChI | InChI=1S/C14H19NO2.C6H11NO/c1-11-4-3-5-14(16)15(11)10-12-6-8-13(17-2)9-7-12;1-5-3-2-4-6(8)7-5/h6-9,11H,3-5,10H2,1-2H3;5H,2-4H2,1H3,(H,7,8) |
| InChIKey | NALGHENRGZRDJW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |