C21H25N3O2 — CID 146469723
1-[(4-methoxyphenyl)methyl]-N'-[(4-methylphenyl)methyl]-5-oxopyrrolidine-2-carboximidamide (PubChem CID 146469723) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-N'-[(4-methylphenyl)methyl]-5-oxopyrrolidine-2-carboximidamide.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-N'-[(4-methylphenyl)methyl]-5-oxopyrrolidine-2-carboximidamide |
|---|---|
| PubChem CID | 146469723 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-N'-[(4-methylphenyl)methyl]-5-oxopyrrolidine-2-carboximidamide |
| SMILES | COc1ccc(CN2C(=O)CCC2/C(N)=N/Cc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H25N3O2/c1-15-3-5-16(6-4-15)13-23-21(22)19-11-12-20(25)24(19)14-17-7-9-18(26-2)10-8-17/h3-10,19H,11-14H2,1-2H3,(H2,22,23) |
| InChIKey | FXOCHHIXIJIISJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|