C20H23ClFN3O2 — CID 155537989
(2S)-1-[(4-fluorophenyl)methyl]-N'-[(4-methoxyphenyl)methyl]-5-oxopyrrolidine-2-carboximidamide;hydrochloride (PubChem CID 155537989) has the molecular formula C20H23ClFN3O2 and a molecular weight of 391.87 g/mol. Its IUPAC name is (2S)-1-[(4-fluorophenyl)methyl]-N'-[(4-methoxyphenyl)methyl]-5-oxopyrrolidine-2-carboximidamide;hydrochloride.
| Compound Name | (2S)-1-[(4-fluorophenyl)methyl]-N'-[(4-methoxyphenyl)methyl]-5-oxopyrrolidine-2-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 155537989 |
| Molecular Formula | C20H23ClFN3O2 |
| Molecular Weight | 391.87 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | (2S)-1-[(4-fluorophenyl)methyl]-N'-[(4-methoxyphenyl)methyl]-5-oxopyrrolidine-2-carboximidamide;hydrochloride |
| SMILES | COc1ccc(C/N=C(\N)[C@@H]2CCC(=O)N2Cc2ccc(F)cc2)cc1.Cl |
| InChI | InChI=1S/C20H22FN3O2.ClH/c1-26-17-8-4-14(5-9-17)12-23-20(22)18-10-11-19(25)24(18)13-15-2-6-16(21)7-3-15;/h2-9,18H,10-13H2,1H3,(H2,22,23);1H/t18-;/m0./s1 |
| InChIKey | KPURVPHBPJBKAJ-FERBBOLQSA-N |
| XLogP | 3.30 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.87 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|