C21H26ClN3O2 — CID 155534976
(2S)-N'-[(4-methoxyphenyl)methyl]-1-[(4-methylphenyl)methyl]-5-oxopyrrolidine-2-carboximidamide;hydrochloride (PubChem CID 155534976) has the molecular formula C21H26ClN3O2 and a molecular weight of 387.91 g/mol. Its IUPAC name is (2S)-N'-[(4-methoxyphenyl)methyl]-1-[(4-methylphenyl)methyl]-5-oxopyrrolidine-2-carboximidamide;hydrochloride.
| Compound Name | (2S)-N'-[(4-methoxyphenyl)methyl]-1-[(4-methylphenyl)methyl]-5-oxopyrrolidine-2-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 155534976 |
| Molecular Formula | C21H26ClN3O2 |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | (2S)-N'-[(4-methoxyphenyl)methyl]-1-[(4-methylphenyl)methyl]-5-oxopyrrolidine-2-carboximidamide;hydrochloride |
| SMILES | COc1ccc(C/N=C(\N)[C@@H]2CCC(=O)N2Cc2ccc(C)cc2)cc1.Cl |
| InChI | InChI=1S/C21H25N3O2.ClH/c1-15-3-5-17(6-4-15)14-24-19(11-12-20(24)25)21(22)23-13-16-7-9-18(26-2)10-8-16;/h3-10,19H,11-14H2,1-2H3,(H2,22,23);1H/t19-;/m0./s1 |
| InChIKey | NJRVEXSVRDUIAB-FYZYNONXSA-N |
| XLogP | 3.47 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|