C21H26N4O4S — CID 151925767
(2S)-N'-[[4-(methanesulfonamido)phenyl]methyl]-1-[(4-methoxyphenyl)methyl]-5-oxopyrrolidine-2-carboximidamide (PubChem CID 151925767) has the molecular formula C21H26N4O4S and a molecular weight of 430.53 g/mol. Its IUPAC name is (2S)-N'-[[4-(methanesulfonamido)phenyl]methyl]-1-[(4-methoxyphenyl)methyl]-5-oxopyrrolidine-2-carboximidamide.
| Compound Name | (2S)-N'-[[4-(methanesulfonamido)phenyl]methyl]-1-[(4-methoxyphenyl)methyl]-5-oxopyrrolidine-2-carboximidamide |
|---|---|
| PubChem CID | 151925767 |
| Molecular Formula | C21H26N4O4S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | (2S)-N'-[[4-(methanesulfonamido)phenyl]methyl]-1-[(4-methoxyphenyl)methyl]-5-oxopyrrolidine-2-carboximidamide |
| SMILES | COc1ccc(CN2C(=O)CC[C@H]2/C(N)=N/Cc2ccc(NS(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C21H26N4O4S/c1-29-18-9-5-16(6-10-18)14-25-19(11-12-20(25)26)21(22)23-13-15-3-7-17(8-4-15)24-30(2,27)28/h3-10,19,24H,11-14H2,1-2H3,(H2,22,23)/t19-/m0/s1 |
| InChIKey | SXSLMPNERRYQIQ-IBGZPJMESA-N |
| XLogP | 2.12 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|